C22H26N6O3 — CID 78714822
2-(2-methyl-1H-indol-3-yl)-N-[5-methyl-2-(4-oxo-6-propyl-1,3-diazinan-2-yl)pyrazol-3-yl]-2-oxoacetamide (PubChem CID 78714822) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-(2-methyl-1H-indol-3-yl)-N-[5-methyl-2-(4-oxo-6-propyl-1,3-diazinan-2-yl)pyrazol-3-yl]-2-oxoacetamide.
| Compound Name | 2-(2-methyl-1H-indol-3-yl)-N-[5-methyl-2-(4-oxo-6-propyl-1,3-diazinan-2-yl)pyrazol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 78714822 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 2-(2-methyl-1H-indol-3-yl)-N-[5-methyl-2-(4-oxo-6-propyl-1,3-diazinan-2-yl)pyrazol-3-yl]-2-oxoacetamide |
| SMILES | CCCC1CC(=O)NC(n2nc(C)cc2NC(=O)C(=O)c2c(C)[nH]c3ccccc23)N1 |
| InChI | InChI=1S/C22H26N6O3/c1-4-7-14-11-18(29)26-22(24-14)28-17(10-12(2)27-28)25-21(31)20(30)19-13(3)23-16-9-6-5-8-15(16)19/h5-6,8-10,14,22-24H,4,7,11H2,1-3H3,(H,25,31)(H,26,29) |
| InChIKey | OADSNRMGSNGWLF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|