C20H26N6O4 — CID 73339846
N-[2-(4-methoxyphenyl)ethyl]-N'-[5-methyl-2-(4-methyl-6-oxo-1,3-diazinan-2-yl)pyrazol-3-yl]oxamide (PubChem CID 73339846) has the molecular formula C20H26N6O4 and a molecular weight of 414.47 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-N'-[5-methyl-2-(4-methyl-6-oxo-1,3-diazinan-2-yl)pyrazol-3-yl]oxamide.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-N'-[5-methyl-2-(4-methyl-6-oxo-1,3-diazinan-2-yl)pyrazol-3-yl]oxamide |
|---|---|
| PubChem CID | 73339846 |
| Molecular Formula | C20H26N6O4 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-N'-[5-methyl-2-(4-methyl-6-oxo-1,3-diazinan-2-yl)pyrazol-3-yl]oxamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)Nc2cc(C)nn2C2NC(=O)CC(C)N2)cc1 |
| InChI | InChI=1S/C20H26N6O4/c1-12-11-17(27)24-20(22-12)26-16(10-13(2)25-26)23-19(29)18(28)21-9-8-14-4-6-15(30-3)7-5-14/h4-7,10,12,20,22H,8-9,11H2,1-3H3,(H,21,28)(H,23,29)(H,24,27) |
| InChIKey | BMLKFZRRXNBVNP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 126.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|