C19H23FN6O3 — CID 73339871
N'-[2-(4-ethyl-6-oxo-1,3-diazinan-2-yl)-5-methylpyrazol-3-yl]-N-[(4-fluorophenyl)methyl]oxamide (PubChem CID 73339871) has the molecular formula C19H23FN6O3 and a molecular weight of 402.43 g/mol. Its IUPAC name is N'-[2-(4-ethyl-6-oxo-1,3-diazinan-2-yl)-5-methylpyrazol-3-yl]-N-[(4-fluorophenyl)methyl]oxamide.
| Compound Name | N'-[2-(4-ethyl-6-oxo-1,3-diazinan-2-yl)-5-methylpyrazol-3-yl]-N-[(4-fluorophenyl)methyl]oxamide |
|---|---|
| PubChem CID | 73339871 |
| Molecular Formula | C19H23FN6O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | N'-[2-(4-ethyl-6-oxo-1,3-diazinan-2-yl)-5-methylpyrazol-3-yl]-N-[(4-fluorophenyl)methyl]oxamide |
| SMILES | CCC1CC(=O)NC(n2nc(C)cc2NC(=O)C(=O)NCc2ccc(F)cc2)N1 |
| InChI | InChI=1S/C19H23FN6O3/c1-3-14-9-16(27)24-19(22-14)26-15(8-11(2)25-26)23-18(29)17(28)21-10-12-4-6-13(20)7-5-12/h4-8,14,19,22H,3,9-10H2,1-2H3,(H,21,28)(H,23,29)(H,24,27) |
| InChIKey | NHQBWQABXNZZNR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 117.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|