C20H25FN6O3 — CID 73339901
N-[(4-fluorophenyl)methyl]-N'-[5-methyl-2-(4-oxo-6-propyl-1,3-diazinan-2-yl)pyrazol-3-yl]oxamide (PubChem CID 73339901) has the molecular formula C20H25FN6O3 and a molecular weight of 416.46 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N'-[5-methyl-2-(4-oxo-6-propyl-1,3-diazinan-2-yl)pyrazol-3-yl]oxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N'-[5-methyl-2-(4-oxo-6-propyl-1,3-diazinan-2-yl)pyrazol-3-yl]oxamide |
|---|---|
| PubChem CID | 73339901 |
| Molecular Formula | C20H25FN6O3 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N'-[5-methyl-2-(4-oxo-6-propyl-1,3-diazinan-2-yl)pyrazol-3-yl]oxamide |
| SMILES | CCCC1CC(=O)NC(n2nc(C)cc2NC(=O)C(=O)NCc2ccc(F)cc2)N1 |
| InChI | InChI=1S/C20H25FN6O3/c1-3-4-15-10-17(28)25-20(23-15)27-16(9-12(2)26-27)24-19(30)18(29)22-11-13-5-7-14(21)8-6-13/h5-9,15,20,23H,3-4,10-11H2,1-2H3,(H,22,29)(H,24,30)(H,25,28) |
| InChIKey | AKLDJQCHCHZDKT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 117.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|