C16H17ClF2N4O — CID 73346173
(2R,3S,5R)-2-(4-chloro-2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine (PubChem CID 73346173) has the molecular formula C16H17ClF2N4O and a molecular weight of 354.79 g/mol. Its IUPAC name is (2R,3S,5R)-2-(4-chloro-2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine.
| Compound Name | (2R,3S,5R)-2-(4-chloro-2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine |
|---|---|
| PubChem CID | 73346173 |
| Molecular Formula | C16H17ClF2N4O |
| Molecular Weight | 354.79 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (2R,3S,5R)-2-(4-chloro-2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)oxan-3-amine |
| SMILES | N[C@H]1C[C@@H](N2Cc3cn[nH]c3C2)CO[C@@H]1c1cc(F)c(Cl)cc1F |
| InChI | InChI=1S/C16H17ClF2N4O/c17-11-3-12(18)10(2-13(11)19)16-14(20)1-9(7-24-16)23-5-8-4-21-22-15(8)6-23/h2-4,9,14,16H,1,5-7,20H2,(H,21,22)/t9-,14+,16-/m1/s1 |
| InChIKey | XIVCZWBCPGNTEN-WKFLNTIRSA-N |
| XLogP | 2.51 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.79 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|