C12H13N3OS2 — CID 73347942
1-[4-methyl-2-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1,3-thiazol-5-yl]ethanone (PubChem CID 73347942) has the molecular formula C12H13N3OS2 and a molecular weight of 279.39 g/mol. Its IUPAC name is 1-[4-methyl-2-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[4-methyl-2-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 73347942 |
| Molecular Formula | C12H13N3OS2 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 1-[4-methyl-2-[(2E)-2-(1-thiophen-2-ylethylidene)hydrazinyl]-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1sc(N/N=C(\C)c2cccs2)nc1C |
| InChI | InChI=1S/C12H13N3OS2/c1-7(10-5-4-6-17-10)14-15-12-13-8(2)11(18-12)9(3)16/h4-6H,1-3H3,(H,13,15)/b14-7+ |
| InChIKey | DOTYTZRFOVMPLN-VGOFMYFVSA-N |
| XLogP | 3.55 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|