C34H28O13S3 — CID 73348080
25,26,27,28-tetrahydroxy-23-phenylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid (PubChem CID 73348080) has the molecular formula C34H28O13S3 and a molecular weight of 740.79 g/mol. Its IUPAC name is 25,26,27,28-tetrahydroxy-23-phenylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid.
| Compound Name | 25,26,27,28-tetrahydroxy-23-phenylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid |
|---|---|
| PubChem CID | 73348080 |
| Molecular Formula | C34H28O13S3 |
| Molecular Weight | 740.79 g/mol |
| Exact Mass | 740.07 |
| IUPAC Name | 25,26,27,28-tetrahydroxy-23-phenylpentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3(28),4,6,9,11,13(27),15,17,19(26),21(25),22-dodecaene-5,11,17-trisulfonic acid |
| SMILES | O=S(=O)(O)c1cc2c(O)c(c1)Cc1cc(S(=O)(=O)O)cc(c1O)Cc1cc(S(=O)(=O)O)cc(c1O)Cc1cc(-c3ccccc3)cc(c1O)C2 |
| InChI | InChI=1S/C34H28O13S3/c35-31-20-6-19(18-4-2-1-3-5-18)7-21(31)9-23-13-29(49(42,43)44)15-25(33(23)37)11-27-17-30(50(45,46)47)16-26(34(27)38)10-24-14-28(48(39,40)41)12-22(8-20)32(24)36/h1-7,12-17,35-38H,8-11H2,(H,39,40,41)(H,42,43,44)(H,45,46,47) |
| InChIKey | YFNBDSGSCMLGRM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 244.03 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.79 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|