C23H28F3NO12 — CID 73348875
(4S,5R,6R)-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-(4-methyl-2-oxochromen-7-yl)oxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid;1,1,1-trifluoroethane (PubChem CID 73348875) has the molecular formula C23H28F3NO12 and a molecular weight of 567.47 g/mol. Its IUPAC name is (4S,5R,6R)-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-(4-methyl-2-oxochromen-7-yl)oxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid;1,1,1-trifluoroethane.
| Compound Name | (4S,5R,6R)-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-(4-methyl-2-oxochromen-7-yl)oxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 73348875 |
| Molecular Formula | C23H28F3NO12 |
| Molecular Weight | 567.47 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | (4S,5R,6R)-4-hydroxy-5-[(2-hydroxyacetyl)amino]-2-(4-methyl-2-oxochromen-7-yl)oxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid;1,1,1-trifluoroethane |
| SMILES | CC(F)(F)F.Cc1cc(=O)oc2cc(OC3(C(=O)O)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@H](O)CO)O3)ccc12 |
| InChI | InChI=1S/C21H25NO12.C2H3F3/c1-9-4-16(28)32-14-5-10(2-3-11(9)14)33-21(20(30)31)6-12(25)17(22-15(27)8-24)19(34-21)18(29)13(26)7-23;1-2(3,4)5/h2-5,12-13,17-19,23-26,29H,6-8H2,1H3,(H,22,27)(H,30,31);1H3/t12-,13+,17+,18+,19+,21?;/m0./s1 |
| InChIKey | DHDMMHPRFYPJFU-JGMGASCZSA-N |
| XLogP | -0.83 |
| TPSA | 216.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.47 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|