C22H14FN3O9 — CID 73356684
2,3-dihydro-1H-inden-1-yl-[5-(5-fluoro-2-hydroxy-3,6-dinitrophenyl)-2-hydroxy-3-nitrophenyl]methanone (PubChem CID 73356684) has the molecular formula C22H14FN3O9 and a molecular weight of 483.36 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-1-yl-[5-(5-fluoro-2-hydroxy-3,6-dinitrophenyl)-2-hydroxy-3-nitrophenyl]methanone.
| Compound Name | 2,3-dihydro-1H-inden-1-yl-[5-(5-fluoro-2-hydroxy-3,6-dinitrophenyl)-2-hydroxy-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 73356684 |
| Molecular Formula | C22H14FN3O9 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | 2,3-dihydro-1H-inden-1-yl-[5-(5-fluoro-2-hydroxy-3,6-dinitrophenyl)-2-hydroxy-3-nitrophenyl]methanone |
| SMILES | O=C(c1cc(-c2c(O)c([N+](=O)[O-])cc(F)c2[N+](=O)[O-])cc([N+](=O)[O-])c1O)C1CCc2ccccc21 |
| InChI | InChI=1S/C22H14FN3O9/c23-15-9-17(25(32)33)22(29)18(19(15)26(34)35)11-7-14(21(28)16(8-11)24(30)31)20(27)13-6-5-10-3-1-2-4-12(10)13/h1-4,7-9,13,28-29H,5-6H2 |
| InChIKey | GHKYENVSFWUIAZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 186.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|