C21H19ClN4O2S — CID 73369355
2-(1,3-benzothiazol-2-yl)-5-[(2-chlorophenyl)methyl]-6-methyl-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione (PubChem CID 73369355) has the molecular formula C21H19ClN4O2S and a molecular weight of 426.93 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-5-[(2-chlorophenyl)methyl]-6-methyl-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-5-[(2-chlorophenyl)methyl]-6-methyl-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione |
|---|---|
| PubChem CID | 73369355 |
| Molecular Formula | C21H19ClN4O2S |
| Molecular Weight | 426.93 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-5-[(2-chlorophenyl)methyl]-6-methyl-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione |
| SMILES | CC1NC2NN(c3nc4ccccc4s3)C(=O)C2C(=O)C1Cc1ccccc1Cl |
| InChI | InChI=1S/C21H19ClN4O2S/c1-11-13(10-12-6-2-3-7-14(12)22)18(27)17-19(23-11)25-26(20(17)28)21-24-15-8-4-5-9-16(15)29-21/h2-9,11,13,17,19,23,25H,10H2,1H3 |
| InChIKey | RZWAMGQQRSDRGE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.93 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|