C17H20N4O2S — CID 73369322
2-(1,3-benzothiazol-2-yl)-6-tert-butyl-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione (PubChem CID 73369322) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-6-tert-butyl-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-6-tert-butyl-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione |
|---|---|
| PubChem CID | 73369322 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-6-tert-butyl-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione |
| SMILES | CC(C)(C)C1CC(=O)C2C(=O)N(c3nc4ccccc4s3)NC2N1 |
| InChI | InChI=1S/C17H20N4O2S/c1-17(2,3)12-8-10(22)13-14(19-12)20-21(15(13)23)16-18-9-6-4-5-7-11(9)24-16/h4-7,12-14,19-20H,8H2,1-3H3 |
| InChIKey | ZJCBNDUAKBTOLX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|