C22H22N4O2S — CID 73369351
2-(1,3-benzothiazol-2-yl)-6-methyl-5-[(3-methylphenyl)methyl]-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione (PubChem CID 73369351) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-6-methyl-5-[(3-methylphenyl)methyl]-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-6-methyl-5-[(3-methylphenyl)methyl]-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione |
|---|---|
| PubChem CID | 73369351 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-6-methyl-5-[(3-methylphenyl)methyl]-1,3a,5,6,7,7a-hexahydropyrazolo[3,4-b]pyridine-3,4-dione |
| SMILES | Cc1cccc(CC2C(=O)C3C(=O)N(c4nc5ccccc5s4)NC3NC2C)c1 |
| InChI | InChI=1S/C22H22N4O2S/c1-12-6-5-7-14(10-12)11-15-13(2)23-20-18(19(15)27)21(28)26(25-20)22-24-16-8-3-4-9-17(16)29-22/h3-10,13,15,18,20,23,25H,11H2,1-2H3 |
| InChIKey | LYGBHKHERMJPTL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|