C28H47Cl2N3O5 — CID 73389480
N,N-bis(2-chloroethyl)-2-[4-[3-[(5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propyl]piperazin-1-yl]acetamide (PubChem CID 73389480) has the molecular formula C28H47Cl2N3O5 and a molecular weight of 576.61 g/mol. Its IUPAC name is N,N-bis(2-chloroethyl)-2-[4-[3-[(5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propyl]piperazin-1-yl]acetamide.
| Compound Name | N,N-bis(2-chloroethyl)-2-[4-[3-[(5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 73389480 |
| Molecular Formula | C28H47Cl2N3O5 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 575.29 |
| IUPAC Name | N,N-bis(2-chloroethyl)-2-[4-[3-[(5R,8S,9R,10R,12R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl]propyl]piperazin-1-yl]acetamide |
| SMILES | C[C@H]1[C@@H](CCCN2CCN(CC(=O)N(CCCl)CCCl)CC2)O[C@@H]2OC3(C)CCC4[C@H](C)CC[C@@H]1C42OO3 |
| InChI | InChI=1S/C28H47Cl2N3O5/c1-20-6-7-23-21(2)24(35-26-28(23)22(20)8-9-27(3,36-26)37-38-28)5-4-12-31-15-17-32(18-16-31)19-25(34)33(13-10-29)14-11-30/h20-24,26H,4-19H2,1-3H3/t20-,21-,22?,23+,24-,26-,27?,28?/m1/s1 |
| InChIKey | AWVHRKAISLFLQI-UTICQHMJSA-N |
| XLogP | 3.94 |
| TPSA | 63.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|