(3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate

C17H26O2 — CID 73407320

IUPAC(3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate
SMILESC=CC(C)=CCC(OC(C)=O)C(=C)CCC=C(C)C
InChIInChI=1S/C17H26O2/c1-7-14(4)11-12-17(19-16(6)18)15(5)10-8-9-13(2)3/h7,9,11,17H,1,5,8,10,12H2,2-4,6H3
InChIKeyAPGBIBLWIBJPQD-UHFFFAOYSA-N
MW262.39 g/mol
LogP4.74
Rot. Bonds8

About (3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate

(3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate (PubChem CID 73407320) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate.

Molecular Properties

Compound Name(3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate
PubChem CID73407320
Molecular FormulaC17H26O2
Molecular Weight262.39 g/mol
Exact Mass262.19
IUPAC Name(3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate
SMILESC=CC(C)=CCC(OC(C)=O)C(=C)CCC=C(C)C
InChIInChI=1S/C17H26O2/c1-7-14(4)11-12-17(19-16(6)18)15(5)10-8-9-13(2)3/h7,9,11,17H,1,5,8,10,12H2,2-4,6H3
InChIKeyAPGBIBLWIBJPQD-UHFFFAOYSA-N
XLogP4.74
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.39
LogP ≤ 54.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate?
The IUPAC name of (3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate (CID 73407320) is (3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate.
What is the SMILES notation for (3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate?
The canonical SMILES for (3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate is C=CC(C)=CCC(OC(C)=O)C(=C)CCC=C(C)C.
What is the InChIKey of (3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate?
The InChIKey is APGBIBLWIBJPQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O2/c1-7-14(4)11-12-17(19-16(6)18)15(5)10-8-9-13(2)3/h7,9,11,17H,1,5,8,10,12H2,2-4,6H3.
What are the key properties of (3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate?
(3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate has a molecular weight of 262.39 g/mol, XLogP of 4.74, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,11-dimethyl-7-methylidenedodeca-1,3,10-trien-6-yl) acetate is sourced from PubChem (CID 73407320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).