C23H34F3NO2 — CID 73425895
(E,7S)-7-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]tetradec-4-enamide (PubChem CID 73425895) has the molecular formula C23H34F3NO2 and a molecular weight of 413.52 g/mol. Its IUPAC name is (E,7S)-7-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]tetradec-4-enamide.
| Compound Name | (E,7S)-7-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]tetradec-4-enamide |
|---|---|
| PubChem CID | 73425895 |
| Molecular Formula | C23H34F3NO2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | (E,7S)-7-methoxy-N-[[4-(trifluoromethyl)phenyl]methyl]tetradec-4-enamide |
| SMILES | CCCCCCC[C@@H](C/C=C/CCC(=O)NCc1ccc(C(F)(F)F)cc1)OC |
| InChI | InChI=1S/C23H34F3NO2/c1-3-4-5-6-8-11-21(29-2)12-9-7-10-13-22(28)27-18-19-14-16-20(17-15-19)23(24,25)26/h7,9,14-17,21H,3-6,8,10-13,18H2,1-2H3,(H,27,28)/b9-7+/t21-/m0/s1 |
| InChIKey | ZDKMNAFGJQEZFU-OEAKIKGJSA-N |
| XLogP | 6.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|