C21H18Cl2N4O4S2 — CID 73427206
2-(5-nitro-2,3-dioxoindol-1-yl)ethyl 4-(3,4-dichlorophenyl)piperazine-1-carbodithioate (PubChem CID 73427206) has the molecular formula C21H18Cl2N4O4S2 and a molecular weight of 525.44 g/mol. Its IUPAC name is 2-(5-nitro-2,3-dioxoindol-1-yl)ethyl 4-(3,4-dichlorophenyl)piperazine-1-carbodithioate.
| Compound Name | 2-(5-nitro-2,3-dioxoindol-1-yl)ethyl 4-(3,4-dichlorophenyl)piperazine-1-carbodithioate |
|---|---|
| PubChem CID | 73427206 |
| Molecular Formula | C21H18Cl2N4O4S2 |
| Molecular Weight | 525.44 g/mol |
| Exact Mass | 524.01 |
| IUPAC Name | 2-(5-nitro-2,3-dioxoindol-1-yl)ethyl 4-(3,4-dichlorophenyl)piperazine-1-carbodithioate |
| SMILES | O=C1C(=O)N(CCSC(=S)N2CCN(c3ccc(Cl)c(Cl)c3)CC2)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C21H18Cl2N4O4S2/c22-16-3-1-13(12-17(16)23)24-5-7-25(8-6-24)21(32)33-10-9-26-18-4-2-14(27(30)31)11-15(18)19(28)20(26)29/h1-4,11-12H,5-10H2 |
| InChIKey | RHFIWHOCSGMWDS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|