C26H28O3 — CID 73431429
5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 73431429) has the molecular formula C26H28O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 73431429 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(C=Cc1ccc2cc(O)c(C34CC5CC(CC(C5)C3)C4)cc2c1)=CC(=O)O |
| InChI | InChI=1S/C26H28O3/c1-16(6-25(28)29)2-3-17-4-5-21-12-24(27)23(11-22(21)10-17)26-13-18-7-19(14-26)9-20(8-18)15-26/h2-6,10-12,18-20,27H,7-9,13-15H2,1H3,(H,28,29) |
| InChIKey | SMCBAWFENKMNHK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|