About 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid
5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 73431429) has the molecular formula C26H28O3
and a molecular weight of 388.51 g/mol. Its IUPAC name is 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid.
Molecular Properties
| Compound Name | 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid |
| PubChem CID | 73431429 |
| Molecular Formula | C26H28O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(C=Cc1ccc2cc(O)c(C34CC5CC(CC(C5)C3)C4)cc2c1)=CC(=O)O |
| InChI | InChI=1S/C26H28O3/c1-16(6-25(28)29)2-3-17-4-5-21-12-24(27)23(11-22(21)10-17)26-13-18-7-19(14-26)9-20(8-18)15-26/h2-6,10-12,18-20,27H,7-9,13-15H2,1H3,(H,28,29) |
| InChIKey | SMCBAWFENKMNHK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid?
The IUPAC name of 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid (CID 73431429) is 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid.
What is the SMILES notation for 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid?
The canonical SMILES for 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid is CC(C=Cc1ccc2cc(O)c(C34CC5CC(CC(C5)C3)C4)cc2c1)=CC(=O)O.
What is the InChIKey of 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid?
The InChIKey is SMCBAWFENKMNHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H28O3/c1-16(6-25(28)29)2-3-17-4-5-21-12-24(27)23(11-22(21)10-17)26-13-18-7-19(14-26)9-20(8-18)15-26/h2-6,10-12,18-20,27H,7-9,13-15H2,1H3,(H,28,29).
What are the key properties of 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid?
5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid has a molecular weight of 388.51 g/mol, XLogP of 6.06, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[7-(1-adamantyl)-6-hydroxynaphthalen-2-yl]-3-methylpenta-2,4-dienoic acid is sourced from PubChem (CID 73431429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).