C10H15NO2 — CID 73442200
(1R,7R,8S)-7-hydroxy-1-[(E)-prop-1-enyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 73442200) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (1R,7R,8S)-7-hydroxy-1-[(E)-prop-1-enyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1R,7R,8S)-7-hydroxy-1-[(E)-prop-1-enyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 73442200 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (1R,7R,8S)-7-hydroxy-1-[(E)-prop-1-enyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | C/C=C/[C@H]1CC(=O)N2CC[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C10H15NO2/c1-2-3-7-6-9(13)11-5-4-8(12)10(7)11/h2-3,7-8,10,12H,4-6H2,1H3/b3-2+/t7-,8+,10-/m0/s1 |
| InChIKey | BNXYYBPPMHFLBV-MLSFTTQVSA-N |
| XLogP | 0.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|