C20H25NO2 — CID 132553079
(1S,2R,3R,4S,6R,9S,12R,13E,17Z,19E)-4-hydroxy-6-methyl-7-azatetracyclo[10.8.0.02,9.03,7]icosa-10,13,17,19-tetraen-8-one (PubChem CID 132553079) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is (1S,2R,3R,4S,6R,9S,12R,13E,17Z,19E)-4-hydroxy-6-methyl-7-azatetracyclo[10.8.0.02,9.03,7]icosa-10,13,17,19-tetraen-8-one.
| Compound Name | (1S,2R,3R,4S,6R,9S,12R,13E,17Z,19E)-4-hydroxy-6-methyl-7-azatetracyclo[10.8.0.02,9.03,7]icosa-10,13,17,19-tetraen-8-one |
|---|---|
| PubChem CID | 132553079 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | (1S,2R,3R,4S,6R,9S,12R,13E,17Z,19E)-4-hydroxy-6-methyl-7-azatetracyclo[10.8.0.02,9.03,7]icosa-10,13,17,19-tetraen-8-one |
| SMILES | C[C@@H]1C[C@H](O)[C@H]2[C@@H]3[C@H]4/C=C/C=C\CC/C=C/[C@@H]4C=C[C@@H]3C(=O)N21 |
| InChI | InChI=1S/C20H25NO2/c1-13-12-17(22)19-18-15-9-7-5-3-2-4-6-8-14(15)10-11-16(18)20(23)21(13)19/h3,5-11,13-19,22H,2,4,12H2,1H3/b5-3-,8-6+,9-7+/t13-,14-,15+,16+,17+,18-,19+/m1/s1 |
| InChIKey | ZTYJLCCKZZUBCN-YLTKNADGSA-N |
| XLogP | 2.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|