C10H15NO3 — CID 71762936
(1R,6S,7S,8S)-6,7-dihydroxy-1-[(E)-prop-1-enyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 71762936) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (1R,6S,7S,8S)-6,7-dihydroxy-1-[(E)-prop-1-enyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1R,6S,7S,8S)-6,7-dihydroxy-1-[(E)-prop-1-enyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 71762936 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (1R,6S,7S,8S)-6,7-dihydroxy-1-[(E)-prop-1-enyl]-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | C/C=C/[C@H]1CC(=O)N2C[C@H](O)[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C10H15NO3/c1-2-3-6-4-8(13)11-5-7(12)10(14)9(6)11/h2-3,6-7,9-10,12,14H,4-5H2,1H3/b3-2+/t6-,7-,9-,10+/m0/s1 |
| InChIKey | YDAKAVFWXZGNHE-IRXOEKPNSA-N |
| XLogP | -0.49 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|