C23H26FN5O3S — CID 73450490
2-[(1,3-dimethyl-2,4-dioxo-7-phenyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl)sulfanyl]-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 73450490) has the molecular formula C23H26FN5O3S and a molecular weight of 471.56 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-2,4-dioxo-7-phenyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl)sulfanyl]-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[(1,3-dimethyl-2,4-dioxo-7-phenyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl)sulfanyl]-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 73450490 |
| Molecular Formula | C23H26FN5O3S |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 2-[(1,3-dimethyl-2,4-dioxo-7-phenyl-4a,5,6,7,8,8a-hexahydropyrimido[4,5-d]pyrimidin-5-yl)sulfanyl]-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | CN1C(=O)C2C(SCC(=O)NCc3ccc(F)cc3)NC(c3ccccc3)NC2N(C)C1=O |
| InChI | InChI=1S/C23H26FN5O3S/c1-28-20-18(22(31)29(2)23(28)32)21(27-19(26-20)15-6-4-3-5-7-15)33-13-17(30)25-12-14-8-10-16(24)11-9-14/h3-11,18-21,26-27H,12-13H2,1-2H3,(H,25,30) |
| InChIKey | SFOVYOBSXZSPDI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |