C31H25N5O3S2 — CID 73450907
[4-(2,5-dimethylphenyl)sulfonylimino-1-oxonaphthalen-2-yl] N'-anilino-N-phenyliminocarbamimidothioate (PubChem CID 73450907) has the molecular formula C31H25N5O3S2 and a molecular weight of 579.71 g/mol. Its IUPAC name is [4-(2,5-dimethylphenyl)sulfonylimino-1-oxonaphthalen-2-yl] N'-anilino-N-phenyliminocarbamimidothioate.
| Compound Name | [4-(2,5-dimethylphenyl)sulfonylimino-1-oxonaphthalen-2-yl] N'-anilino-N-phenyliminocarbamimidothioate |
|---|---|
| PubChem CID | 73450907 |
| Molecular Formula | C31H25N5O3S2 |
| Molecular Weight | 579.71 g/mol |
| Exact Mass | 579.14 |
| IUPAC Name | [4-(2,5-dimethylphenyl)sulfonylimino-1-oxonaphthalen-2-yl] N'-anilino-N-phenyliminocarbamimidothioate |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N=C2C=C(SC(=NNc3ccccc3)/N=N\c3ccccc3)C(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C31H25N5O3S2/c1-21-17-18-22(2)29(19-21)41(38,39)36-27-20-28(30(37)26-16-10-9-15-25(26)27)40-31(34-32-23-11-5-3-6-12-23)35-33-24-13-7-4-8-14-24/h3-20,32H,1-2H3/b34-31?,35-33-,36-27? |
| InChIKey | DAAMLGHWDYQWNG-ZFLYRGRASA-N |
| XLogP | 7.46 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.71 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|