C17H20N3O5+ — CID 7353227
ethyl (1'S,3S,8'S)-5-nitro-2-oxospiro[1H-indole-3,3'-2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium]-1'-carboxylate (PubChem CID 7353227) has the molecular formula C17H20N3O5+ and a molecular weight of 346.36 g/mol. Its IUPAC name is ethyl (1'S,3S,8'S)-5-nitro-2-oxospiro[1H-indole-3,3'-2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium]-1'-carboxylate.
| Compound Name | ethyl (1'S,3S,8'S)-5-nitro-2-oxospiro[1H-indole-3,3'-2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium]-1'-carboxylate |
|---|---|
| PubChem CID | 7353227 |
| Molecular Formula | C17H20N3O5+ |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | ethyl (1'S,3S,8'S)-5-nitro-2-oxospiro[1H-indole-3,3'-2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium]-1'-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@]2(C(=O)Nc3ccc([N+](=O)[O-])cc32)[NH+]2CCC[C@@H]12 |
| InChI | InChI=1S/C17H19N3O5/c1-2-25-15(21)11-9-17(19-7-3-4-14(11)19)12-8-10(20(23)24)5-6-13(12)18-16(17)22/h5-6,8,11,14H,2-4,7,9H2,1H3,(H,18,22)/p+1/t11-,14-,17-/m0/s1 |
| InChIKey | NHOQVTSGODSKOH-YLVFBTJISA-O |
| XLogP | 0.37 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|