C18H22FN2O3+ — CID 7200364
ethyl (1R,3R,8S)-5'-fluoro-1'-methyl-2'-oxospiro[2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-3,3'-indole]-1-carboxylate (PubChem CID 7200364) has the molecular formula C18H22FN2O3+ and a molecular weight of 333.38 g/mol. Its IUPAC name is ethyl (1R,3R,8S)-5'-fluoro-1'-methyl-2'-oxospiro[2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-3,3'-indole]-1-carboxylate.
| Compound Name | ethyl (1R,3R,8S)-5'-fluoro-1'-methyl-2'-oxospiro[2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-3,3'-indole]-1-carboxylate |
|---|---|
| PubChem CID | 7200364 |
| Molecular Formula | C18H22FN2O3+ |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | ethyl (1R,3R,8S)-5'-fluoro-1'-methyl-2'-oxospiro[2,4,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-3,3'-indole]-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@]2(C(=O)N(C)c3ccc(F)cc32)[NH+]2CCC[C@@H]12 |
| InChI | InChI=1S/C18H21FN2O3/c1-3-24-16(22)12-10-18(21-8-4-5-14(12)21)13-9-11(19)6-7-15(13)20(2)17(18)23/h6-7,9,12,14H,3-5,8,10H2,1-2H3/p+1/t12-,14+,18-/m1/s1 |
| InChIKey | YUIKNVICEBMPCT-UVBSCNOISA-O |
| XLogP | 0.63 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |