C25H32N2+2 — CID 7353369
(2S,6R)-4-(1-adamantyl)-1-benzyl-2,6-diethynylpiperazine-1,4-diium (PubChem CID 7353369) has the molecular formula C25H32N2+2 and a molecular weight of 360.55 g/mol. Its IUPAC name is (2S,6R)-4-(1-adamantyl)-1-benzyl-2,6-diethynylpiperazine-1,4-diium.
| Compound Name | (2S,6R)-4-(1-adamantyl)-1-benzyl-2,6-diethynylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 7353369 |
| Molecular Formula | C25H32N2+2 |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | (2S,6R)-4-(1-adamantyl)-1-benzyl-2,6-diethynylpiperazine-1,4-diium |
| SMILES | C#C[C@@H]1C[NH+](C23CC4CC(CC(C4)C2)C3)C[C@H](C#C)[NH+]1Cc1ccccc1 |
| InChI | InChI=1S/C25H30N2/c1-3-23-17-26(25-13-20-10-21(14-25)12-22(11-20)15-25)18-24(4-2)27(23)16-19-8-6-5-7-9-19/h1-2,5-9,20-24H,10-18H2/p+2/t20?,21?,22?,23-,24+,25? |
| InChIKey | RZPRZMVXVOSGBW-VSWHNUGGSA-P |
| XLogP | 0.94 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|