C25H30N2 — CID 7353370
(2R,6S)-4-(1-adamantyl)-1-benzyl-2,6-diethynylpiperazine (PubChem CID 7353370) has the molecular formula C25H30N2 and a molecular weight of 358.53 g/mol. Its IUPAC name is (2R,6S)-4-(1-adamantyl)-1-benzyl-2,6-diethynylpiperazine.
| Compound Name | (2R,6S)-4-(1-adamantyl)-1-benzyl-2,6-diethynylpiperazine |
|---|---|
| PubChem CID | 7353370 |
| Molecular Formula | C25H30N2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | (2R,6S)-4-(1-adamantyl)-1-benzyl-2,6-diethynylpiperazine |
| SMILES | C#C[C@@H]1CN(C23CC4CC(CC(C4)C2)C3)C[C@H](C#C)N1Cc1ccccc1 |
| InChI | InChI=1S/C25H30N2/c1-3-23-17-26(25-13-20-10-21(14-25)12-22(11-20)15-25)18-24(4-2)27(23)16-19-8-6-5-7-9-19/h1-2,5-9,20-24H,10-18H2/t20?,21?,22?,23-,24+,25? |
| InChIKey | RZPRZMVXVOSGBW-VSWHNUGGSA-N |
| XLogP | 3.78 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|