C21H29NO2 — CID 19097415
ethyl 2-benzyl-8-ethyl-3,4-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate (PubChem CID 19097415) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is ethyl 2-benzyl-8-ethyl-3,4-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate.
| Compound Name | ethyl 2-benzyl-8-ethyl-3,4-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate |
|---|---|
| PubChem CID | 19097415 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | ethyl 2-benzyl-8-ethyl-3,4-dimethyl-2-azabicyclo[2.2.2]oct-7-ene-6-carboxylate |
| SMILES | CCOC(=O)C1CC2(C)C(CC)=CC1N(Cc1ccccc1)C2C |
| InChI | InChI=1S/C21H29NO2/c1-5-17-12-19-18(20(23)24-6-2)13-21(17,4)15(3)22(19)14-16-10-8-7-9-11-16/h7-12,15,18-19H,5-6,13-14H2,1-4H3 |
| InChIKey | WDUPMLLBBWELHQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|