C26H35N3O2 — CID 7356460
(2S)-N-[4-(4-hexanoylpiperazin-1-yl)phenyl]-2-phenylbutanamide (PubChem CID 7356460) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is (2S)-N-[4-(4-hexanoylpiperazin-1-yl)phenyl]-2-phenylbutanamide.
| Compound Name | (2S)-N-[4-(4-hexanoylpiperazin-1-yl)phenyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 7356460 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | (2S)-N-[4-(4-hexanoylpiperazin-1-yl)phenyl]-2-phenylbutanamide |
| SMILES | CCCCCC(=O)N1CCN(c2ccc(NC(=O)[C@@H](CC)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C26H35N3O2/c1-3-5-7-12-25(30)29-19-17-28(18-20-29)23-15-13-22(14-16-23)27-26(31)24(4-2)21-10-8-6-9-11-21/h6,8-11,13-16,24H,3-5,7,12,17-20H2,1-2H3,(H,27,31)/t24-/m0/s1 |
| InChIKey | VHKBAZZFZGXVLV-DEOSSOPVSA-N |
| XLogP | 5.05 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|