C20H15N3O5S — CID 7359861
(3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 7359861) has the molecular formula C20H15N3O5S and a molecular weight of 409.42 g/mol. Its IUPAC name is (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 7359861 |
| Molecular Formula | C20H15N3O5S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | (3-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)OCc3cc(=O)n4c(C)csc4n3)cc2C1=O |
| InChI | InChI=1S/C20H15N3O5S/c1-3-6-22-17(25)14-5-4-12(7-15(14)18(22)26)19(27)28-9-13-8-16(24)23-11(2)10-29-20(23)21-13/h3-5,7-8,10H,1,6,9H2,2H3 |
| InChIKey | KCQHTHQZJOAVJX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|