C26H23N3O5S — CID 16510636
[2-(N-acetyl-2-ethylanilino)-1,3-thiazol-4-yl]methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate (PubChem CID 16510636) has the molecular formula C26H23N3O5S and a molecular weight of 489.55 g/mol. Its IUPAC name is [2-(N-acetyl-2-ethylanilino)-1,3-thiazol-4-yl]methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate.
| Compound Name | [2-(N-acetyl-2-ethylanilino)-1,3-thiazol-4-yl]methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
|---|---|
| PubChem CID | 16510636 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | [2-(N-acetyl-2-ethylanilino)-1,3-thiazol-4-yl]methyl 1,3-dioxo-2-prop-2-enylisoindole-5-carboxylate |
| SMILES | C=CCN1C(=O)c2ccc(C(=O)OCc3csc(N(C(C)=O)c4ccccc4CC)n3)cc2C1=O |
| InChI | InChI=1S/C26H23N3O5S/c1-4-12-28-23(31)20-11-10-18(13-21(20)24(28)32)25(33)34-14-19-15-35-26(27-19)29(16(3)30)22-9-7-6-8-17(22)5-2/h4,6-11,13,15H,1,5,12,14H2,2-3H3 |
| InChIKey | DADOKYYDAPEMQW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|