C14H18Cl3N2O3S+ — CID 7360340
[(3S)-1,1-dioxothiolan-3-yl]-[(1S)-2,2,2-trichloro-1-[(2-methylbenzoyl)amino]ethyl]azanium (PubChem CID 7360340) has the molecular formula C14H18Cl3N2O3S+ and a molecular weight of 400.74 g/mol. Its IUPAC name is [(3S)-1,1-dioxothiolan-3-yl]-[(1S)-2,2,2-trichloro-1-[(2-methylbenzoyl)amino]ethyl]azanium.
| Compound Name | [(3S)-1,1-dioxothiolan-3-yl]-[(1S)-2,2,2-trichloro-1-[(2-methylbenzoyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 7360340 |
| Molecular Formula | C14H18Cl3N2O3S+ |
| Molecular Weight | 400.74 g/mol |
| Exact Mass | 399.01 |
| IUPAC Name | [(3S)-1,1-dioxothiolan-3-yl]-[(1S)-2,2,2-trichloro-1-[(2-methylbenzoyl)amino]ethyl]azanium |
| SMILES | Cc1ccccc1C(=O)N[C@@H]([NH2+][C@H]1CCS(=O)(=O)C1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H17Cl3N2O3S/c1-9-4-2-3-5-11(9)12(20)19-13(14(15,16)17)18-10-6-7-23(21,22)8-10/h2-5,10,13,18H,6-8H2,1H3,(H,19,20)/p+1/t10-,13+/m0/s1 |
| InChIKey | WSTCKDUJSLYIQT-GXFFZTMASA-O |
| XLogP | 1.17 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.74 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|