C14H25N4O2S+ — CID 7367048
3-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-dimethylazanium (PubChem CID 7367048) has the molecular formula C14H25N4O2S+ and a molecular weight of 313.45 g/mol. Its IUPAC name is 3-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-dimethylazanium.
| Compound Name | 3-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7367048 |
| Molecular Formula | C14H25N4O2S+ |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 3-[(1,3-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylideneamino]propyl-dimethylazanium |
| SMILES | CCN1C(=O)C(/C=N/CCC[NH+](C)C)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C14H24N4O2S/c1-5-17-12(19)11(10-15-8-7-9-16(3)4)13(20)18(6-2)14(17)21/h10-11H,5-9H2,1-4H3/p+1/b15-10+ |
| InChIKey | ZNNWUYXWNMODIO-XNTDXEJSSA-O |
| XLogP | -0.80 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|