C12H21N4O2S+ — CID 7367086
3-[[(5R)-1-ethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium (PubChem CID 7367086) has the molecular formula C12H21N4O2S+ and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-[[(5R)-1-ethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium.
| Compound Name | 3-[[(5R)-1-ethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7367086 |
| Molecular Formula | C12H21N4O2S+ |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 3-[[(5R)-1-ethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium |
| SMILES | CCN1C(=O)[C@H](/C=N/CCC[NH+](C)C)C(=O)NC1=S |
| InChI | InChI=1S/C12H20N4O2S/c1-4-16-11(18)9(10(17)14-12(16)19)8-13-6-5-7-15(2)3/h8-9H,4-7H2,1-3H3,(H,14,17,19)/p+1/b13-8+/t9-/m1/s1 |
| InChIKey | COXFBZZUAHIFGR-TVNQGELYSA-O |
| XLogP | -1.53 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|