C19H28NO2+ — CID 7371477
(2S)-1-[4-[(1S)-cyclopent-2-en-1-yl]phenoxy]-3-piperidin-1-ium-1-ylpropan-2-ol (PubChem CID 7371477) has the molecular formula C19H28NO2+ and a molecular weight of 302.44 g/mol. Its IUPAC name is (2S)-1-[4-[(1S)-cyclopent-2-en-1-yl]phenoxy]-3-piperidin-1-ium-1-ylpropan-2-ol.
| Compound Name | (2S)-1-[4-[(1S)-cyclopent-2-en-1-yl]phenoxy]-3-piperidin-1-ium-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 7371477 |
| Molecular Formula | C19H28NO2+ |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (2S)-1-[4-[(1S)-cyclopent-2-en-1-yl]phenoxy]-3-piperidin-1-ium-1-ylpropan-2-ol |
| SMILES | O[C@H](COc1ccc([C@@H]2C=CCC2)cc1)C[NH+]1CCCCC1 |
| InChI | InChI=1S/C19H27NO2/c21-18(14-20-12-4-1-5-13-20)15-22-19-10-8-17(9-11-19)16-6-2-3-7-16/h2,6,8-11,16,18,21H,1,3-5,7,12-15H2/p+1/t16-,18+/m1/s1 |
| InChIKey | OOORMPLAZXXCBH-AEFFLSMTSA-O |
| XLogP | 1.93 |
| TPSA | 33.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|