C11H9FN2OS — CID 737186
2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 737186) has the molecular formula C11H9FN2OS and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 737186 |
| Molecular Formula | C11H9FN2OS |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | NC(=O)Cc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C11H9FN2OS/c12-8-3-1-7(2-4-8)9-6-16-11(14-9)5-10(13)15/h1-4,6H,5H2,(H2,13,15) |
| InChIKey | GXDBXDJTVFKURZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |