C20H21ClN2O — CID 737936
N-(3-chlorophenyl)-2,2,4,6-tetramethylquinoline-1-carboxamide (PubChem CID 737936) has the molecular formula C20H21ClN2O and a molecular weight of 340.85 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2,2,4,6-tetramethylquinoline-1-carboxamide.
| Compound Name | N-(3-chlorophenyl)-2,2,4,6-tetramethylquinoline-1-carboxamide |
|---|---|
| PubChem CID | 737936 |
| Molecular Formula | C20H21ClN2O |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-(3-chlorophenyl)-2,2,4,6-tetramethylquinoline-1-carboxamide |
| SMILES | CC1=CC(C)(C)N(C(=O)Nc2cccc(Cl)c2)c2ccc(C)cc21 |
| InChI | InChI=1S/C20H21ClN2O/c1-13-8-9-18-17(10-13)14(2)12-20(3,4)23(18)19(24)22-16-7-5-6-15(21)11-16/h5-12H,1-4H3,(H,22,24) |
| InChIKey | LZLGLMIWGHIOBG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |