C22H28ClN6+ — CID 7384196
1-[(R)-(1-tert-butyltetrazol-5-yl)-(2-chlorophenyl)methyl]-4-phenylpiperazin-1-ium (PubChem CID 7384196) has the molecular formula C22H28ClN6+ and a molecular weight of 411.96 g/mol. Its IUPAC name is 1-[(R)-(1-tert-butyltetrazol-5-yl)-(2-chlorophenyl)methyl]-4-phenylpiperazin-1-ium.
| Compound Name | 1-[(R)-(1-tert-butyltetrazol-5-yl)-(2-chlorophenyl)methyl]-4-phenylpiperazin-1-ium |
|---|---|
| PubChem CID | 7384196 |
| Molecular Formula | C22H28ClN6+ |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 1-[(R)-(1-tert-butyltetrazol-5-yl)-(2-chlorophenyl)methyl]-4-phenylpiperazin-1-ium |
| SMILES | CC(C)(C)n1nnnc1[C@@H](c1ccccc1Cl)[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H27ClN6/c1-22(2,3)29-21(24-25-26-29)20(18-11-7-8-12-19(18)23)28-15-13-27(14-16-28)17-9-5-4-6-10-17/h4-12,20H,13-16H2,1-3H3/p+1/t20-/m1/s1 |
| InChIKey | YSZWYJHSFSHPMK-HXUWFJFHSA-O |
| XLogP | 2.58 |
| TPSA | 51.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |