C18H20N3O+ — CID 7384764
2-(3-methylanilino)-1-(2-phenylethyl)-4H-imidazol-3-ium-5-one (PubChem CID 7384764) has the molecular formula C18H20N3O+ and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-(3-methylanilino)-1-(2-phenylethyl)-4H-imidazol-3-ium-5-one.
| Compound Name | 2-(3-methylanilino)-1-(2-phenylethyl)-4H-imidazol-3-ium-5-one |
|---|---|
| PubChem CID | 7384764 |
| Molecular Formula | C18H20N3O+ |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-(3-methylanilino)-1-(2-phenylethyl)-4H-imidazol-3-ium-5-one |
| SMILES | Cc1cccc(NC2=[NH+]CC(=O)N2CCc2ccccc2)c1 |
| InChI | InChI=1S/C18H19N3O/c1-14-6-5-9-16(12-14)20-18-19-13-17(22)21(18)11-10-15-7-3-2-4-8-15/h2-9,12H,10-11,13H2,1H3,(H,19,20)/p+1 |
| InChIKey | XDOXNVNICLPTQR-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 46.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |