C11H15N3S — CID 738558
5-(2-phenylethyl)-1,3,5-triazinane-2-thione (PubChem CID 738558) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 5-(2-phenylethyl)-1,3,5-triazinane-2-thione.
| Compound Name | 5-(2-phenylethyl)-1,3,5-triazinane-2-thione |
|---|---|
| PubChem CID | 738558 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 5-(2-phenylethyl)-1,3,5-triazinane-2-thione |
| SMILES | S=C1NCN(CCc2ccccc2)CN1 |
| InChI | InChI=1S/C11H15N3S/c15-11-12-8-14(9-13-11)7-6-10-4-2-1-3-5-10/h1-5H,6-9H2,(H2,12,13,15) |
| InChIKey | DERVQHYGLXXOOB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|