C28H28Cl2F3O7PS — CID 74012304
[4-[4-[2-[4,4-bis(4-chlorophenyl)butylsulfonyl]ethoxy]phenyl]-1,1,1-trifluorobut-2-en-2-yl] dihydrogen phosphate (PubChem CID 74012304) has the molecular formula C28H28Cl2F3O7PS and a molecular weight of 667.47 g/mol. Its IUPAC name is [4-[4-[2-[4,4-bis(4-chlorophenyl)butylsulfonyl]ethoxy]phenyl]-1,1,1-trifluorobut-2-en-2-yl] dihydrogen phosphate.
| Compound Name | [4-[4-[2-[4,4-bis(4-chlorophenyl)butylsulfonyl]ethoxy]phenyl]-1,1,1-trifluorobut-2-en-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 74012304 |
| Molecular Formula | C28H28Cl2F3O7PS |
| Molecular Weight | 667.47 g/mol |
| Exact Mass | 666.06 |
| IUPAC Name | [4-[4-[2-[4,4-bis(4-chlorophenyl)butylsulfonyl]ethoxy]phenyl]-1,1,1-trifluorobut-2-en-2-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC(=CCc1ccc(OCCS(=O)(=O)CCCC(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C28H28Cl2F3O7PS/c29-23-10-6-21(7-11-23)26(22-8-12-24(30)13-9-22)2-1-18-42(37,38)19-17-39-25-14-3-20(4-15-25)5-16-27(28(31,32)33)40-41(34,35)36/h3-4,6-16,26H,1-2,5,17-19H2,(H2,34,35,36) |
| InChIKey | VPYICVMDJJNUJV-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.47 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|