C17H16N2 — CID 74015785
2,12,13-trimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-1,3,5,8,10,12,14-heptaene (PubChem CID 74015785) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2,12,13-trimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-1,3,5,8,10,12,14-heptaene.
| Compound Name | 2,12,13-trimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-1,3,5,8,10,12,14-heptaene |
|---|---|
| PubChem CID | 74015785 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2,12,13-trimethyl-8,15-diazatetracyclo[8.5.1.03,14.04,11]hexadeca-1,3,5,8,10,12,14-heptaene |
| SMILES | CC1=C2CC3=c4c(C)c(C)c(c1c4C=CC/N=C\3)=N2 |
| InChI | InChI=1S/C17H16N2/c1-9-10(2)17-16-11(3)14(19-17)7-12-8-18-6-4-5-13(16)15(9)12/h4-5,8H,6-7H2,1-3H3/b5-4?,18-8- |
| InChIKey | JLOCRXXXZFXWBO-CKRNSDFWSA-N |
| XLogP | 2.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |