About 1-[(1S,5R)-9-(2-methylpropyl)-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-propylthiourea
1-[(1S,5R)-9-(2-methylpropyl)-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-propylthiourea (PubChem CID 7402866) has the molecular formula C16H32N3S+
and a molecular weight of 298.52 g/mol. Its IUPAC name is 1-[(1S,5R)-9-(2-methylpropyl)-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-propylthiourea.
Molecular Properties
| Compound Name | 1-[(1S,5R)-9-(2-methylpropyl)-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-propylthiourea |
| PubChem CID | 7402866 |
| Molecular Formula | C16H32N3S+ |
| Molecular Weight | 298.52 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 1-[(1S,5R)-9-(2-methylpropyl)-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-propylthiourea |
| SMILES | CCCNC(=S)NC1C[C@H]2CCC[C@@H](C1)[NH+]2CC(C)C |
| InChI | InChI=1S/C16H31N3S/c1-4-8-17-16(20)18-13-9-14-6-5-7-15(10-13)19(14)11-12(2)3/h12-15H,4-11H2,1-3H3,(H2,17,18,20)/p+1/t13?,14-,15+ |
| InChIKey | BEYRRGIQRBONHQ-GOOCMWNKSA-O |
| XLogP | 1.48 |
| TPSA | 28.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.52 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1S,5R)-9-(2-methylpropyl)-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-propylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,5R)-9-(2-methylpropyl)-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-propylthiourea?
The IUPAC name of 1-[(1S,5R)-9-(2-methylpropyl)-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-propylthiourea (CID 7402866) is 1-[(1S,5R)-9-(2-methylpropyl)-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-propylthiourea.
What is the SMILES notation for 1-[(1S,5R)-9-(2-methylpropyl)-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-propylthiourea?
The canonical SMILES for 1-[(1S,5R)-9-(2-methylpropyl)-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-propylthiourea is CCCNC(=S)NC1C[C@H]2CCC[C@@H](C1)[NH+]2CC(C)C.
What is the InChIKey of 1-[(1S,5R)-9-(2-methylpropyl)-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-propylthiourea?
The InChIKey is BEYRRGIQRBONHQ-GOOCMWNKSA-O. The full InChI is InChI=1S/C16H31N3S/c1-4-8-17-16(20)18-13-9-14-6-5-7-15(10-13)19(14)11-12(2)3/h12-15H,4-11H2,1-3H3,(H2,17,18,20)/p+1/t13?,14-,15+.
What are the key properties of 1-[(1S,5R)-9-(2-methylpropyl)-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-propylthiourea?
1-[(1S,5R)-9-(2-methylpropyl)-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-propylthiourea has a molecular weight of 298.52 g/mol, XLogP of 1.48, 5 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,5R)-9-(2-methylpropyl)-9-azoniabicyclo[3.3.1]nonan-3-yl]-3-propylthiourea is sourced from PubChem (CID 7402866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).