C16H25NS — CID 74052240
(1,3-dimethyl-5-propan-2-yl-2-tricyclo[4.3.1.03,7]decanyl) thiocyanate (PubChem CID 74052240) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is (1,3-dimethyl-5-propan-2-yl-2-tricyclo[4.3.1.03,7]decanyl) thiocyanate.
| Compound Name | (1,3-dimethyl-5-propan-2-yl-2-tricyclo[4.3.1.03,7]decanyl) thiocyanate |
|---|---|
| PubChem CID | 74052240 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (1,3-dimethyl-5-propan-2-yl-2-tricyclo[4.3.1.03,7]decanyl) thiocyanate |
| SMILES | CC(C)C1CC2(C)C3CCC(C)(CC13)C2SC#N |
| InChI | InChI=1S/C16H25NS/c1-10(2)11-8-16(4)13-5-6-15(3,7-12(11)13)14(16)18-9-17/h10-14H,5-8H2,1-4H3 |
| InChIKey | NPFROIIKMDPVFR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|