C12H20INO3 — CID 74062294
[4-(3-iodo-1-methoxyprop-2-enyl)-1-methylpiperidin-3-yl] acetate (PubChem CID 74062294) has the molecular formula C12H20INO3 and a molecular weight of 353.20 g/mol. Its IUPAC name is [4-(3-iodo-1-methoxyprop-2-enyl)-1-methylpiperidin-3-yl] acetate.
| Compound Name | [4-(3-iodo-1-methoxyprop-2-enyl)-1-methylpiperidin-3-yl] acetate |
|---|---|
| PubChem CID | 74062294 |
| Molecular Formula | C12H20INO3 |
| Molecular Weight | 353.20 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | [4-(3-iodo-1-methoxyprop-2-enyl)-1-methylpiperidin-3-yl] acetate |
| SMILES | COC(C=CI)C1CCN(C)CC1OC(C)=O |
| InChI | InChI=1S/C12H20INO3/c1-9(15)17-12-8-14(2)7-5-10(12)11(16-3)4-6-13/h4,6,10-12H,5,7-8H2,1-3H3 |
| InChIKey | PNLBVOGAWWEEGM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|