C13H25N2O2+ — CID 7406234
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-(2-methoxyethyl)azanium (PubChem CID 7406234) has the molecular formula C13H25N2O2+ and a molecular weight of 241.35 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-(2-methoxyethyl)azanium.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-(2-methoxyethyl)azanium |
|---|---|
| PubChem CID | 7406234 |
| Molecular Formula | C13H25N2O2+ |
| Molecular Weight | 241.35 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-(2-methoxyethyl)azanium |
| SMILES | COCC[NH2+]CC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C13H24N2O2/c1-17-10-9-14-11-13(16)15-8-7-12-5-3-2-4-6-12/h5,14H,2-4,6-11H2,1H3,(H,15,16)/p+1 |
| InChIKey | MLCHKOKIOKGECY-UHFFFAOYSA-O |
| XLogP | 0.20 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.35 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|