C19H31N4O6+ — CID 7408618
(2S,3R)-2-[[(2S)-6-azaniumyl-2-[[(2S)-2-azaniumyl-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-hydroxybutanoate (PubChem CID 7408618) has the molecular formula C19H31N4O6+ and a molecular weight of 411.48 g/mol. Its IUPAC name is (2S,3R)-2-[[(2S)-6-azaniumyl-2-[[(2S)-2-azaniumyl-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-hydroxybutanoate.
| Compound Name | (2S,3R)-2-[[(2S)-6-azaniumyl-2-[[(2S)-2-azaniumyl-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 7408618 |
| Molecular Formula | C19H31N4O6+ |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | (2S,3R)-2-[[(2S)-6-azaniumyl-2-[[(2S)-2-azaniumyl-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-3-hydroxybutanoate |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@H](CCCC[NH3+])NC(=O)[C@@H]([NH3+])Cc1ccc(O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C19H30N4O6/c1-11(24)16(19(28)29)23-18(27)15(4-2-3-9-20)22-17(26)14(21)10-12-5-7-13(25)8-6-12/h5-8,11,14-16,24-25H,2-4,9-10,20-21H2,1H3,(H,22,26)(H,23,27)(H,28,29)/p+1/t11-,14+,15+,16+/m1/s1 |
| InChIKey | SINRIKQYQJRGDQ-MEYUZBJRSA-O |
| XLogP | -3.94 |
| TPSA | 194.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | -3.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|