C18H25O4- — CID 7410046
(3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-(2-methoxyphenyl)butanoate (PubChem CID 7410046) has the molecular formula C18H25O4- and a molecular weight of 305.39 g/mol. Its IUPAC name is (3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-(2-methoxyphenyl)butanoate.
| Compound Name | (3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-(2-methoxyphenyl)butanoate |
|---|---|
| PubChem CID | 7410046 |
| Molecular Formula | C18H25O4- |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (3R)-3-[(4R)-2,2-dimethyloxan-4-yl]-4-(2-methoxyphenyl)butanoate |
| SMILES | COc1ccccc1C[C@H](CC(=O)[O-])[C@@H]1CCOC(C)(C)C1 |
| InChI | InChI=1S/C18H26O4/c1-18(2)12-14(8-9-22-18)15(11-17(19)20)10-13-6-4-5-7-16(13)21-3/h4-7,14-15H,8-12H2,1-3H3,(H,19,20)/p-1/t14-,15-/m1/s1 |
| InChIKey | QJIWYGNJXDMZRQ-HUUCEWRRSA-M |
| XLogP | 2.20 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |