C23H26N3O3+ — CID 7410272
(3R)-3-(4-benzoylpiperazin-1-ium-1-yl)-1-(2,4-dimethylphenyl)pyrrolidine-2,5-dione (PubChem CID 7410272) has the molecular formula C23H26N3O3+ and a molecular weight of 392.48 g/mol. Its IUPAC name is (3R)-3-(4-benzoylpiperazin-1-ium-1-yl)-1-(2,4-dimethylphenyl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(4-benzoylpiperazin-1-ium-1-yl)-1-(2,4-dimethylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7410272 |
| Molecular Formula | C23H26N3O3+ |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (3R)-3-(4-benzoylpiperazin-1-ium-1-yl)-1-(2,4-dimethylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(N2C(=O)C[C@@H]([NH+]3CCN(C(=O)c4ccccc4)CC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C23H25N3O3/c1-16-8-9-19(17(2)14-16)26-21(27)15-20(23(26)29)24-10-12-25(13-11-24)22(28)18-6-4-3-5-7-18/h3-9,14,20H,10-13,15H2,1-2H3/p+1/t20-/m1/s1 |
| InChIKey | CPNDYWSZYNXDPI-HXUWFJFHSA-O |
| XLogP | 0.98 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|