C17H21N7O4 — CID 74221680
2-[(Z)-[3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ylidene]amino]oxy-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide (PubChem CID 74221680) has the molecular formula C17H21N7O4 and a molecular weight of 387.40 g/mol. Its IUPAC name is 2-[(Z)-[3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ylidene]amino]oxy-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[(Z)-[3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ylidene]amino]oxy-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 74221680 |
| Molecular Formula | C17H21N7O4 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-[(Z)-[3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-ylidene]amino]oxy-N-[(E)-(2-nitrophenyl)methylideneamino]acetamide |
| SMILES | CC(C)(C)/C(Cn1cncn1)=N/OCC(=O)N/N=C/c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N7O4/c1-17(2,3)15(9-23-12-18-11-20-23)22-28-10-16(25)21-19-8-13-6-4-5-7-14(13)24(26)27/h4-8,11-12H,9-10H2,1-3H3,(H,21,25)/b19-8+,22-15+ |
| InChIKey | WCSISVWNEJFAAU-AGNNKGLZSA-N |
| XLogP | 1.76 |
| TPSA | 136.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|