C22H25N7O2S — CID 74221755
N-[(1S)-1-[5-(1H-indazol-5-yl)-1H-imidazol-2-yl]-7-(methylamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide (PubChem CID 74221755) has the molecular formula C22H25N7O2S and a molecular weight of 451.56 g/mol. Its IUPAC name is N-[(1S)-1-[5-(1H-indazol-5-yl)-1H-imidazol-2-yl]-7-(methylamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(1S)-1-[5-(1H-indazol-5-yl)-1H-imidazol-2-yl]-7-(methylamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 74221755 |
| Molecular Formula | C22H25N7O2S |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | N-[(1S)-1-[5-(1H-indazol-5-yl)-1H-imidazol-2-yl]-7-(methylamino)-7-oxoheptyl]-1,3-thiazole-5-carboxamide |
| SMILES | CNC(=O)CCCCC[C@H](NC(=O)c1cncs1)c1ncc(-c2ccc3[nH]ncc3c2)[nH]1 |
| InChI | InChI=1S/C22H25N7O2S/c1-23-20(30)6-4-2-3-5-17(28-22(31)19-12-24-13-32-19)21-25-11-18(27-21)14-7-8-16-15(9-14)10-26-29-16/h7-13,17H,2-6H2,1H3,(H,23,30)(H,25,27)(H,26,29)(H,28,31)/t17-/m0/s1 |
| InChIKey | OSJWOCFXGRWZRK-KRWDZBQOSA-N |
| XLogP | 3.58 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|